C16H13FN2O3S — CID 41074060
(5S)-3-[2-(2-fluorophenyl)-2-oxoethyl]-5-methyl-5-thiophen-2-ylimidazolidine-2,4-dione (PubChem CID 41074060) has the molecular formula C16H13FN2O3S and a molecular weight of 332.36 g/mol. Its IUPAC name is (5S)-3-[2-(2-fluorophenyl)-2-oxoethyl]-5-methyl-5-thiophen-2-ylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-(2-fluorophenyl)-2-oxoethyl]-5-methyl-5-thiophen-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41074060 |
| Molecular Formula | C16H13FN2O3S |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | (5S)-3-[2-(2-fluorophenyl)-2-oxoethyl]-5-methyl-5-thiophen-2-ylimidazolidine-2,4-dione |
| SMILES | C[C@]1(c2cccs2)NC(=O)N(CC(=O)c2ccccc2F)C1=O |
| InChI | InChI=1S/C16H13FN2O3S/c1-16(13-7-4-8-23-13)14(21)19(15(22)18-16)9-12(20)10-5-2-3-6-11(10)17/h2-8H,9H2,1H3,(H,18,22)/t16-/m1/s1 |
| InChIKey | GAWDUJDEHAGVRP-MRXNPFEDSA-N |
| XLogP | 2.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|