C15H21N3O3S — CID 51288708
2-(4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl)-N-pentylacetamide (PubChem CID 51288708) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-(4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl)-N-pentylacetamide.
| Compound Name | 2-(4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl)-N-pentylacetamide |
|---|---|
| PubChem CID | 51288708 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-(4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl)-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CN1C(=O)NC(C)(c2cccs2)C1=O |
| InChI | InChI=1S/C15H21N3O3S/c1-3-4-5-8-16-12(19)10-18-13(20)15(2,17-14(18)21)11-7-6-9-22-11/h6-7,9H,3-5,8,10H2,1-2H3,(H,16,19)(H,17,21) |
| InChIKey | ZHDOMEGOFVKEEG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|