C21H20F2N2O6 — CID 47094642
methyl 4-[3-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-hydroxypropoxy]benzoate (PubChem CID 47094642) has the molecular formula C21H20F2N2O6 and a molecular weight of 434.40 g/mol. Its IUPAC name is methyl 4-[3-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-hydroxypropoxy]benzoate.
| Compound Name | methyl 4-[3-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-hydroxypropoxy]benzoate |
|---|---|
| PubChem CID | 47094642 |
| Molecular Formula | C21H20F2N2O6 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | methyl 4-[3-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-hydroxypropoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCC(O)CN2C(=O)NC(C)(c3cc(F)ccc3F)C2=O)cc1 |
| InChI | InChI=1S/C21H20F2N2O6/c1-21(16-9-13(22)5-8-17(16)23)19(28)25(20(29)24-21)10-14(26)11-31-15-6-3-12(4-7-15)18(27)30-2/h3-9,14,26H,10-11H2,1-2H3,(H,24,29) |
| InChIKey | WWFWTKJEQCVVTF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|