C26H23F2N3O5 — CID 46815453
methyl 4-[3-[2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 46815453) has the molecular formula C26H23F2N3O5 and a molecular weight of 495.48 g/mol. Its IUPAC name is methyl 4-[3-[2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | methyl 4-[3-[2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 46815453 |
| Molecular Formula | C26H23F2N3O5 |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | methyl 4-[3-[2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(-n2c(C)cc(C(=O)CN3C(=O)NC(C)(c4cc(F)ccc4F)C3=O)c2C)cc1 |
| InChI | InChI=1S/C26H23F2N3O5/c1-14-11-19(15(2)31(14)18-8-5-16(6-9-18)23(33)36-4)22(32)13-30-24(34)26(3,29-25(30)35)20-12-17(27)7-10-21(20)28/h5-12H,13H2,1-4H3,(H,29,35) |
| InChIKey | FPMFFCUNVCBUNX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|