C25H21F2N3O3 — CID 42944281
3-(3-carbazol-9-yl-2-hydroxypropyl)-5-(2,5-difluorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 42944281) has the molecular formula C25H21F2N3O3 and a molecular weight of 449.46 g/mol. Its IUPAC name is 3-(3-carbazol-9-yl-2-hydroxypropyl)-5-(2,5-difluorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-(3-carbazol-9-yl-2-hydroxypropyl)-5-(2,5-difluorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42944281 |
| Molecular Formula | C25H21F2N3O3 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 3-(3-carbazol-9-yl-2-hydroxypropyl)-5-(2,5-difluorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2cc(F)ccc2F)NC(=O)N(CC(O)Cn2c3ccccc3c3ccccc32)C1=O |
| InChI | InChI=1S/C25H21F2N3O3/c1-25(19-12-15(26)10-11-20(19)27)23(32)30(24(33)28-25)14-16(31)13-29-21-8-4-2-6-17(21)18-7-3-5-9-22(18)29/h2-12,16,31H,13-14H2,1H3,(H,28,33) |
| InChIKey | QSULWKVZZNHWJU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|