C23H23ClFNO2 — CID 18224684
1-[(2-chloro-6-fluorophenyl)methyl-methylamino]-3-(4-phenylphenoxy)propan-2-ol (PubChem CID 18224684) has the molecular formula C23H23ClFNO2 and a molecular weight of 399.89 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl-methylamino]-3-(4-phenylphenoxy)propan-2-ol.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl-methylamino]-3-(4-phenylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 18224684 |
| Molecular Formula | C23H23ClFNO2 |
| Molecular Weight | 399.89 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl-methylamino]-3-(4-phenylphenoxy)propan-2-ol |
| SMILES | CN(Cc1c(F)cccc1Cl)CC(O)COc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23ClFNO2/c1-26(15-21-22(24)8-5-9-23(21)25)14-19(27)16-28-20-12-10-18(11-13-20)17-6-3-2-4-7-17/h2-13,19,27H,14-16H2,1H3 |
| InChIKey | AMYCGADOGKMWGQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.89 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |