C11H14Cl3N — CID 63388129
2-chloro-N-[(2,6-dichlorophenyl)methyl]-N-methylpropan-1-amine (PubChem CID 63388129) has the molecular formula C11H14Cl3N and a molecular weight of 266.60 g/mol. Its IUPAC name is 2-chloro-N-[(2,6-dichlorophenyl)methyl]-N-methylpropan-1-amine.
| Compound Name | 2-chloro-N-[(2,6-dichlorophenyl)methyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 63388129 |
| Molecular Formula | C11H14Cl3N |
| Molecular Weight | 266.60 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 2-chloro-N-[(2,6-dichlorophenyl)methyl]-N-methylpropan-1-amine |
| SMILES | CC(Cl)CN(C)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H14Cl3N/c1-8(12)6-15(2)7-9-10(13)4-3-5-11(9)14/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | SGHXMRUYKNWCAA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|