C11H13Cl3 — CID 63459849
1,3-dichloro-2-(3-chloro-2-methylbutyl)benzene (PubChem CID 63459849) has the molecular formula C11H13Cl3 and a molecular weight of 251.58 g/mol. Its IUPAC name is 1,3-dichloro-2-(3-chloro-2-methylbutyl)benzene.
| Compound Name | 1,3-dichloro-2-(3-chloro-2-methylbutyl)benzene |
|---|---|
| PubChem CID | 63459849 |
| Molecular Formula | C11H13Cl3 |
| Molecular Weight | 251.58 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 1,3-dichloro-2-(3-chloro-2-methylbutyl)benzene |
| SMILES | CC(Cl)C(C)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H13Cl3/c1-7(8(2)12)6-9-10(13)4-3-5-11(9)14/h3-5,7-8H,6H2,1-2H3 |
| InChIKey | UQOZDGQDZPRXEW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|