C12H13Cl3O — CID 103344124
5-chloro-3-[(2,6-dichlorophenyl)methyl]pentan-2-one (PubChem CID 103344124) has the molecular formula C12H13Cl3O and a molecular weight of 279.59 g/mol. Its IUPAC name is 5-chloro-3-[(2,6-dichlorophenyl)methyl]pentan-2-one.
| Compound Name | 5-chloro-3-[(2,6-dichlorophenyl)methyl]pentan-2-one |
|---|---|
| PubChem CID | 103344124 |
| Molecular Formula | C12H13Cl3O |
| Molecular Weight | 279.59 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 5-chloro-3-[(2,6-dichlorophenyl)methyl]pentan-2-one |
| SMILES | CC(=O)C(CCCl)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H13Cl3O/c1-8(16)9(5-6-13)7-10-11(14)3-2-4-12(10)15/h2-4,9H,5-7H2,1H3 |
| InChIKey | IBFVBXCNJIALGQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|