C12H12Cl2O4 — CID 103972399
dimethyl 2-[(2,6-dichlorophenyl)methyl]propanedioate (PubChem CID 103972399) has the molecular formula C12H12Cl2O4 and a molecular weight of 291.13 g/mol. Its IUPAC name is dimethyl 2-[(2,6-dichlorophenyl)methyl]propanedioate.
| Compound Name | dimethyl 2-[(2,6-dichlorophenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 103972399 |
| Molecular Formula | C12H12Cl2O4 |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | dimethyl 2-[(2,6-dichlorophenyl)methyl]propanedioate |
| SMILES | COC(=O)C(Cc1c(Cl)cccc1Cl)C(=O)OC |
| InChI | InChI=1S/C12H12Cl2O4/c1-17-11(15)8(12(16)18-2)6-7-9(13)4-3-5-10(7)14/h3-5,8H,6H2,1-2H3 |
| InChIKey | ZSSFCNIFVORNGA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|