C17H18Cl2N2O2 — CID 129363549
methyl (2S)-3-(4-aminophenyl)-2-[(2,6-dichlorophenyl)methylamino]propanoate (PubChem CID 129363549) has the molecular formula C17H18Cl2N2O2 and a molecular weight of 353.25 g/mol. Its IUPAC name is methyl (2S)-3-(4-aminophenyl)-2-[(2,6-dichlorophenyl)methylamino]propanoate.
| Compound Name | methyl (2S)-3-(4-aminophenyl)-2-[(2,6-dichlorophenyl)methylamino]propanoate |
|---|---|
| PubChem CID | 129363549 |
| Molecular Formula | C17H18Cl2N2O2 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | methyl (2S)-3-(4-aminophenyl)-2-[(2,6-dichlorophenyl)methylamino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(N)cc1)NCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H18Cl2N2O2/c1-23-17(22)16(9-11-5-7-12(20)8-6-11)21-10-13-14(18)3-2-4-15(13)19/h2-8,16,21H,9-10,20H2,1H3/t16-/m0/s1 |
| InChIKey | FQWCEXNLYIPQLG-INIZCTEOSA-N |
| XLogP | 3.45 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|