C16H15ClFNO5S — CID 167765633
methyl 2-[(3-chloro-2-hydroxyphenyl)sulfonylamino]-3-(4-fluorophenyl)propanoate (PubChem CID 167765633) has the molecular formula C16H15ClFNO5S and a molecular weight of 387.82 g/mol. Its IUPAC name is methyl 2-[(3-chloro-2-hydroxyphenyl)sulfonylamino]-3-(4-fluorophenyl)propanoate.
| Compound Name | methyl 2-[(3-chloro-2-hydroxyphenyl)sulfonylamino]-3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 167765633 |
| Molecular Formula | C16H15ClFNO5S |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | methyl 2-[(3-chloro-2-hydroxyphenyl)sulfonylamino]-3-(4-fluorophenyl)propanoate |
| SMILES | COC(=O)C(Cc1ccc(F)cc1)NS(=O)(=O)c1cccc(Cl)c1O |
| InChI | InChI=1S/C16H15ClFNO5S/c1-24-16(21)13(9-10-5-7-11(18)8-6-10)19-25(22,23)14-4-2-3-12(17)15(14)20/h2-8,13,19-20H,9H2,1H3 |
| InChIKey | YJVPGWHDQGNHTJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |