C16H16INO6S — CID 101343894
methyl (2S)-2-[(2-iodylphenyl)sulfonylamino]-3-phenylpropanoate (PubChem CID 101343894) has the molecular formula C16H16INO6S and a molecular weight of 477.28 g/mol. Its IUPAC name is methyl (2S)-2-[(2-iodylphenyl)sulfonylamino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[(2-iodylphenyl)sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 101343894 |
| Molecular Formula | C16H16INO6S |
| Molecular Weight | 477.28 g/mol |
| Exact Mass | 476.97 |
| IUPAC Name | methyl (2S)-2-[(2-iodylphenyl)sulfonylamino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NS(=O)(=O)c1ccccc1I(=O)=O |
| InChI | InChI=1S/C16H16INO6S/c1-24-16(19)14(11-12-7-3-2-4-8-12)18-25(22,23)15-10-6-5-9-13(15)17(20)21/h2-10,14,18H,11H2,1H3/t14-/m0/s1 |
| InChIKey | OXPZWTMVKDOMPU-AWEZNQCLSA-N |
| XLogP | 2.12 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|