C17H17ClFN3O3 — CID 16959753
2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-N-(4-methyl-2-nitrophenyl)acetamide (PubChem CID 16959753) has the molecular formula C17H17ClFN3O3 and a molecular weight of 365.79 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-N-(4-methyl-2-nitrophenyl)acetamide.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-N-(4-methyl-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 16959753 |
| Molecular Formula | C17H17ClFN3O3 |
| Molecular Weight | 365.79 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-N-(4-methyl-2-nitrophenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN(C)Cc2c(F)cccc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17ClFN3O3/c1-11-6-7-15(16(8-11)22(24)25)20-17(23)10-21(2)9-12-13(18)4-3-5-14(12)19/h3-8H,9-10H2,1-2H3,(H,20,23) |
| InChIKey | LQGMYILVGDMJEO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.79 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|