C12H15BrClNO2 — CID 115605565
methyl 3-[(4-bromo-2-chlorophenyl)methyl-methylamino]propanoate (PubChem CID 115605565) has the molecular formula C12H15BrClNO2 and a molecular weight of 320.61 g/mol. Its IUPAC name is methyl 3-[(4-bromo-2-chlorophenyl)methyl-methylamino]propanoate.
| Compound Name | methyl 3-[(4-bromo-2-chlorophenyl)methyl-methylamino]propanoate |
|---|---|
| PubChem CID | 115605565 |
| Molecular Formula | C12H15BrClNO2 |
| Molecular Weight | 320.61 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | methyl 3-[(4-bromo-2-chlorophenyl)methyl-methylamino]propanoate |
| SMILES | COC(=O)CCN(C)Cc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C12H15BrClNO2/c1-15(6-5-12(16)17-2)8-9-3-4-10(13)7-11(9)14/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | SVBYFKPGDDZDHO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.61 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |