C17H21N3OS — CID 173169464
N-butyl-2-(naphthalen-1-ylcarbamothioylamino)acetamide (PubChem CID 173169464) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is N-butyl-2-(naphthalen-1-ylcarbamothioylamino)acetamide.
| Compound Name | N-butyl-2-(naphthalen-1-ylcarbamothioylamino)acetamide |
|---|---|
| PubChem CID | 173169464 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-butyl-2-(naphthalen-1-ylcarbamothioylamino)acetamide |
| SMILES | CCCCNC(=O)CNC(=S)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C17H21N3OS/c1-2-3-11-18-16(21)12-19-17(22)20-15-10-6-8-13-7-4-5-9-14(13)15/h4-10H,2-3,11-12H2,1H3,(H,18,21)(H2,19,20,22) |
| InChIKey | LGMNFCHQSNQWAN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|