C16H20BrF3N2O6S — CID 3865702
methyl 2-[[2-[[4-bromo-2-(trifluoromethoxy)phenyl]sulfonylamino]acetyl]amino]hexanoate (PubChem CID 3865702) has the molecular formula C16H20BrF3N2O6S and a molecular weight of 505.31 g/mol. Its IUPAC name is methyl 2-[[2-[[4-bromo-2-(trifluoromethoxy)phenyl]sulfonylamino]acetyl]amino]hexanoate.
| Compound Name | methyl 2-[[2-[[4-bromo-2-(trifluoromethoxy)phenyl]sulfonylamino]acetyl]amino]hexanoate |
|---|---|
| PubChem CID | 3865702 |
| Molecular Formula | C16H20BrF3N2O6S |
| Molecular Weight | 505.31 g/mol |
| Exact Mass | 504.02 |
| IUPAC Name | methyl 2-[[2-[[4-bromo-2-(trifluoromethoxy)phenyl]sulfonylamino]acetyl]amino]hexanoate |
| SMILES | CCCCC(NC(=O)CNS(=O)(=O)c1ccc(Br)cc1OC(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C16H20BrF3N2O6S/c1-3-4-5-11(15(24)27-2)22-14(23)9-21-29(25,26)13-7-6-10(17)8-12(13)28-16(18,19)20/h6-8,11,21H,3-5,9H2,1-2H3,(H,22,23) |
| InChIKey | FERFBTFCGJPQOA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |