C14H19BrF3NO3S — CID 3427000
4-bromo-N-heptan-2-yl-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 3427000) has the molecular formula C14H19BrF3NO3S and a molecular weight of 418.28 g/mol. Its IUPAC name is 4-bromo-N-heptan-2-yl-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | 4-bromo-N-heptan-2-yl-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 3427000 |
| Molecular Formula | C14H19BrF3NO3S |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | 4-bromo-N-heptan-2-yl-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CCCCCC(C)NS(=O)(=O)c1ccc(Br)cc1OC(F)(F)F |
| InChI | InChI=1S/C14H19BrF3NO3S/c1-3-4-5-6-10(2)19-23(20,21)13-8-7-11(15)9-12(13)22-14(16,17)18/h7-10,19H,3-6H2,1-2H3 |
| InChIKey | YZLILSFUGHNNCP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|