C11H13BrF3NO5S — CID 3866448
4-bromo-N-(2,2-dimethoxyethyl)-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 3866448) has the molecular formula C11H13BrF3NO5S and a molecular weight of 408.19 g/mol. Its IUPAC name is 4-bromo-N-(2,2-dimethoxyethyl)-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | 4-bromo-N-(2,2-dimethoxyethyl)-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 3866448 |
| Molecular Formula | C11H13BrF3NO5S |
| Molecular Weight | 408.19 g/mol |
| Exact Mass | 406.96 |
| IUPAC Name | 4-bromo-N-(2,2-dimethoxyethyl)-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | COC(CNS(=O)(=O)c1ccc(Br)cc1OC(F)(F)F)OC |
| InChI | InChI=1S/C11H13BrF3NO5S/c1-19-10(20-2)6-16-22(17,18)9-4-3-7(12)5-8(9)21-11(13,14)15/h3-5,10,16H,6H2,1-2H3 |
| InChIKey | FVVNMZQVFOGQAM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.19 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|