C15H13BrF3NO5S — CID 3740454
4-bromo-N-(3,5-dimethoxyphenyl)-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 3740454) has the molecular formula C15H13BrF3NO5S and a molecular weight of 456.24 g/mol. Its IUPAC name is 4-bromo-N-(3,5-dimethoxyphenyl)-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | 4-bromo-N-(3,5-dimethoxyphenyl)-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 3740454 |
| Molecular Formula | C15H13BrF3NO5S |
| Molecular Weight | 456.24 g/mol |
| Exact Mass | 454.96 |
| IUPAC Name | 4-bromo-N-(3,5-dimethoxyphenyl)-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(Br)cc2OC(F)(F)F)cc(OC)c1 |
| InChI | InChI=1S/C15H13BrF3NO5S/c1-23-11-6-10(7-12(8-11)24-2)20-26(21,22)14-4-3-9(16)5-13(14)25-15(17,18)19/h3-8,20H,1-2H3 |
| InChIKey | CTBQKBHWTCNQRF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.24 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |