C17H17BrF3NO3S — CID 3861912
4-bromo-N-(2-tert-butylphenyl)-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 3861912) has the molecular formula C17H17BrF3NO3S and a molecular weight of 452.29 g/mol. Its IUPAC name is 4-bromo-N-(2-tert-butylphenyl)-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | 4-bromo-N-(2-tert-butylphenyl)-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 3861912 |
| Molecular Formula | C17H17BrF3NO3S |
| Molecular Weight | 452.29 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | 4-bromo-N-(2-tert-butylphenyl)-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CC(C)(C)c1ccccc1NS(=O)(=O)c1ccc(Br)cc1OC(F)(F)F |
| InChI | InChI=1S/C17H17BrF3NO3S/c1-16(2,3)12-6-4-5-7-13(12)22-26(23,24)15-9-8-11(18)10-14(15)25-17(19,20)21/h4-10,22H,1-3H3 |
| InChIKey | BXJMOGXPHOUDMW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.29 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |