C16H17BrClNO2S — CID 7939182
4-bromo-N-(2-tert-butylphenyl)-2-chlorobenzenesulfonamide (PubChem CID 7939182) has the molecular formula C16H17BrClNO2S and a molecular weight of 402.74 g/mol. Its IUPAC name is 4-bromo-N-(2-tert-butylphenyl)-2-chlorobenzenesulfonamide.
| Compound Name | 4-bromo-N-(2-tert-butylphenyl)-2-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 7939182 |
| Molecular Formula | C16H17BrClNO2S |
| Molecular Weight | 402.74 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | 4-bromo-N-(2-tert-butylphenyl)-2-chlorobenzenesulfonamide |
| SMILES | CC(C)(C)c1ccccc1NS(=O)(=O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C16H17BrClNO2S/c1-16(2,3)12-6-4-5-7-14(12)19-22(20,21)15-9-8-11(17)10-13(15)18/h4-10,19H,1-3H3 |
| InChIKey | IGFYATFIAPZAEI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.74 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |