C11H12BrF3N2O4S — CID 141430379
2-[[4-bromo-2-(trifluoromethoxy)phenyl]sulfonylamino]-2-methylpropanamide (PubChem CID 141430379) has the molecular formula C11H12BrF3N2O4S and a molecular weight of 405.19 g/mol. Its IUPAC name is 2-[[4-bromo-2-(trifluoromethoxy)phenyl]sulfonylamino]-2-methylpropanamide.
| Compound Name | 2-[[4-bromo-2-(trifluoromethoxy)phenyl]sulfonylamino]-2-methylpropanamide |
|---|---|
| PubChem CID | 141430379 |
| Molecular Formula | C11H12BrF3N2O4S |
| Molecular Weight | 405.19 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | 2-[[4-bromo-2-(trifluoromethoxy)phenyl]sulfonylamino]-2-methylpropanamide |
| SMILES | CC(C)(NS(=O)(=O)c1ccc(Br)cc1OC(F)(F)F)C(N)=O |
| InChI | InChI=1S/C11H12BrF3N2O4S/c1-10(2,9(16)18)17-22(19,20)8-4-3-6(12)5-7(8)21-11(13,14)15/h3-5,17H,1-2H3,(H2,16,18) |
| InChIKey | RNUCZWLOUUDCHI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |