C16H15BrF3NO4S — CID 4997303
4-bromo-N-[1-(4-methoxyphenyl)ethyl]-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 4997303) has the molecular formula C16H15BrF3NO4S and a molecular weight of 454.26 g/mol. Its IUPAC name is 4-bromo-N-[1-(4-methoxyphenyl)ethyl]-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | 4-bromo-N-[1-(4-methoxyphenyl)ethyl]-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 4997303 |
| Molecular Formula | C16H15BrF3NO4S |
| Molecular Weight | 454.26 g/mol |
| Exact Mass | 452.99 |
| IUPAC Name | 4-bromo-N-[1-(4-methoxyphenyl)ethyl]-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | COc1ccc(C(C)NS(=O)(=O)c2ccc(Br)cc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H15BrF3NO4S/c1-10(11-3-6-13(24-2)7-4-11)21-26(22,23)15-8-5-12(17)9-14(15)25-16(18,19)20/h3-10,21H,1-2H3 |
| InChIKey | XABZAIGCDHUNFQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.26 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |