C15H13BrF3NO4S — CID 74227940
4-bromo-N-[(1R)-2-hydroxy-1-phenylethyl]-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 74227940) has the molecular formula C15H13BrF3NO4S and a molecular weight of 440.24 g/mol. Its IUPAC name is 4-bromo-N-[(1R)-2-hydroxy-1-phenylethyl]-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | 4-bromo-N-[(1R)-2-hydroxy-1-phenylethyl]-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 74227940 |
| Molecular Formula | C15H13BrF3NO4S |
| Molecular Weight | 440.24 g/mol |
| Exact Mass | 438.97 |
| IUPAC Name | 4-bromo-N-[(1R)-2-hydroxy-1-phenylethyl]-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(N[C@@H](CO)c1ccccc1)c1ccc(Br)cc1OC(F)(F)F |
| InChI | InChI=1S/C15H13BrF3NO4S/c16-11-6-7-14(13(8-11)24-15(17,18)19)25(22,23)20-12(9-21)10-4-2-1-3-5-10/h1-8,12,20-21H,9H2/t12-/m0/s1 |
| InChIKey | NXOFOZPGAYUFFK-LBPRGKRZSA-N |
| XLogP | 3.36 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.24 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |