C10H10F3NO6S — CID 80755925
(2R)-3-hydroxy-2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]propanoic acid (PubChem CID 80755925) has the molecular formula C10H10F3NO6S and a molecular weight of 329.25 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]propanoic acid.
| Compound Name | (2R)-3-hydroxy-2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 80755925 |
| Molecular Formula | C10H10F3NO6S |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | (2R)-3-hydroxy-2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]propanoic acid |
| SMILES | O=C(O)[C@@H](CO)NS(=O)(=O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C10H10F3NO6S/c11-10(12,13)20-7-3-1-2-4-8(7)21(18,19)14-6(5-15)9(16)17/h1-4,6,14-15H,5H2,(H,16,17)/t6-/m1/s1 |
| InChIKey | IDMSPYIKJJCJQY-ZCFIWIBFSA-N |
| XLogP | 0.31 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |