C9H10F3NO4S — CID 43502048
N-(2-hydroxyethyl)-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 43502048) has the molecular formula C9H10F3NO4S and a molecular weight of 285.24 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(2-hydroxyethyl)-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 43502048 |
| Molecular Formula | C9H10F3NO4S |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | N-(2-hydroxyethyl)-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(NCCO)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C9H10F3NO4S/c10-9(11,12)17-7-3-1-2-4-8(7)18(15,16)13-5-6-14/h1-4,13-14H,5-6H2 |
| InChIKey | WKPXLKCFVPODKU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |