C14H19F3N2O4S — CID 47062308
N,N-diethyl-3-[[2-(trifluoromethoxy)phenyl]sulfonylamino]propanamide (PubChem CID 47062308) has the molecular formula C14H19F3N2O4S and a molecular weight of 368.38 g/mol. Its IUPAC name is N,N-diethyl-3-[[2-(trifluoromethoxy)phenyl]sulfonylamino]propanamide.
| Compound Name | N,N-diethyl-3-[[2-(trifluoromethoxy)phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 47062308 |
| Molecular Formula | C14H19F3N2O4S |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N,N-diethyl-3-[[2-(trifluoromethoxy)phenyl]sulfonylamino]propanamide |
| SMILES | CCN(CC)C(=O)CCNS(=O)(=O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C14H19F3N2O4S/c1-3-19(4-2)13(20)9-10-18-24(21,22)12-8-6-5-7-11(12)23-14(15,16)17/h5-8,18H,3-4,9-10H2,1-2H3 |
| InChIKey | GSKHHALTXLMLAL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |