C12H14F3NO5S — CID 3689825
propan-2-yl 2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]acetate (PubChem CID 3689825) has the molecular formula C12H14F3NO5S and a molecular weight of 341.31 g/mol. Its IUPAC name is propan-2-yl 2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]acetate.
| Compound Name | propan-2-yl 2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 3689825 |
| Molecular Formula | C12H14F3NO5S |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | propan-2-yl 2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]acetate |
| SMILES | CC(C)OC(=O)CNS(=O)(=O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C12H14F3NO5S/c1-8(2)20-11(17)7-16-22(18,19)10-6-4-3-5-9(10)21-12(13,14)15/h3-6,8,16H,7H2,1-2H3 |
| InChIKey | RTCYQYILBQNEGM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |