C10H13F3N2O3S — CID 63731279
N-(2-aminopropyl)-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 63731279) has the molecular formula C10H13F3N2O3S and a molecular weight of 298.29 g/mol. Its IUPAC name is N-(2-aminopropyl)-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(2-aminopropyl)-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 63731279 |
| Molecular Formula | C10H13F3N2O3S |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | N-(2-aminopropyl)-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CC(N)CNS(=O)(=O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C10H13F3N2O3S/c1-7(14)6-15-19(16,17)9-5-3-2-4-8(9)18-10(11,12)13/h2-5,7,15H,6,14H2,1H3 |
| InChIKey | FZCCWDGDKJEMNE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |