C18H15F3N2O3S — CID 71269687
N-[(E,2R)-4-cyano-1-phenylbut-3-en-2-yl]-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 71269687) has the molecular formula C18H15F3N2O3S and a molecular weight of 396.39 g/mol. Its IUPAC name is N-[(E,2R)-4-cyano-1-phenylbut-3-en-2-yl]-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[(E,2R)-4-cyano-1-phenylbut-3-en-2-yl]-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 71269687 |
| Molecular Formula | C18H15F3N2O3S |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | N-[(E,2R)-4-cyano-1-phenylbut-3-en-2-yl]-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | N#C/C=C/[C@@H](Cc1ccccc1)NS(=O)(=O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C18H15F3N2O3S/c19-18(20,21)26-16-10-4-5-11-17(16)27(24,25)23-15(9-6-12-22)13-14-7-2-1-3-8-14/h1-11,15,23H,13H2/b9-6+/t15-/m0/s1 |
| InChIKey | QPNILFIGSINACR-PPYMECGQSA-N |
| XLogP | 3.55 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|