C10H13NO5S — CID 80750989
(2R)-3-hydroxy-2-[(2-methylphenyl)sulfonylamino]propanoic acid (PubChem CID 80750989) has the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-[(2-methylphenyl)sulfonylamino]propanoic acid.
| Compound Name | (2R)-3-hydroxy-2-[(2-methylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 80750989 |
| Molecular Formula | C10H13NO5S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | (2R)-3-hydroxy-2-[(2-methylphenyl)sulfonylamino]propanoic acid |
| SMILES | Cc1ccccc1S(=O)(=O)N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C10H13NO5S/c1-7-4-2-3-5-9(7)17(15,16)11-8(6-12)10(13)14/h2-5,8,11-12H,6H2,1H3,(H,13,14)/t8-/m1/s1 |
| InChIKey | UHASKEUCFGNCIK-MRVPVSSYSA-N |
| XLogP | -0.28 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |