C14H18BrF3N2O5S — CID 162639899
tert-butyl N-[2-[[4-bromo-2-(trifluoromethoxy)phenyl]sulfonylamino]ethyl]carbamate (PubChem CID 162639899) has the molecular formula C14H18BrF3N2O5S and a molecular weight of 463.27 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-bromo-2-(trifluoromethoxy)phenyl]sulfonylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-bromo-2-(trifluoromethoxy)phenyl]sulfonylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 162639899 |
| Molecular Formula | C14H18BrF3N2O5S |
| Molecular Weight | 463.27 g/mol |
| Exact Mass | 462.01 |
| IUPAC Name | tert-butyl N-[2-[[4-bromo-2-(trifluoromethoxy)phenyl]sulfonylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNS(=O)(=O)c1ccc(Br)cc1OC(F)(F)F |
| InChI | InChI=1S/C14H18BrF3N2O5S/c1-13(2,3)25-12(21)19-6-7-20-26(22,23)11-5-4-9(15)8-10(11)24-14(16,17)18/h4-5,8,20H,6-7H2,1-3H3,(H,19,21) |
| InChIKey | XNOQVMPVFPCZGO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.27 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|