C18H29BrN2O4S — CID 164863853
tert-butyl N-[7-[(4-bromophenyl)sulfonylamino]heptyl]carbamate (PubChem CID 164863853) has the molecular formula C18H29BrN2O4S and a molecular weight of 449.41 g/mol. Its IUPAC name is tert-butyl N-[7-[(4-bromophenyl)sulfonylamino]heptyl]carbamate.
| Compound Name | tert-butyl N-[7-[(4-bromophenyl)sulfonylamino]heptyl]carbamate |
|---|---|
| PubChem CID | 164863853 |
| Molecular Formula | C18H29BrN2O4S |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | tert-butyl N-[7-[(4-bromophenyl)sulfonylamino]heptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCCNS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H29BrN2O4S/c1-18(2,3)25-17(22)20-13-7-5-4-6-8-14-21-26(23,24)16-11-9-15(19)10-12-16/h9-12,21H,4-8,13-14H2,1-3H3,(H,20,22) |
| InChIKey | RAHIPQRKMKZMDQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|