C12H15BrN2O4S — CID 89104122
prop-1-en-2-yl N-[2-[(4-bromophenyl)sulfonylamino]ethyl]carbamate (PubChem CID 89104122) has the molecular formula C12H15BrN2O4S and a molecular weight of 363.23 g/mol. Its IUPAC name is prop-1-en-2-yl N-[2-[(4-bromophenyl)sulfonylamino]ethyl]carbamate.
| Compound Name | prop-1-en-2-yl N-[2-[(4-bromophenyl)sulfonylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 89104122 |
| Molecular Formula | C12H15BrN2O4S |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | prop-1-en-2-yl N-[2-[(4-bromophenyl)sulfonylamino]ethyl]carbamate |
| SMILES | C=C(C)OC(=O)NCCNS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H15BrN2O4S/c1-9(2)19-12(16)14-7-8-15-20(17,18)11-5-3-10(13)4-6-11/h3-6,15H,1,7-8H2,2H3,(H,14,16) |
| InChIKey | SDCBKTWZEUVPLY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|