C10H12BrNO4S — CID 146272473
propylcarbamoyl 4-bromobenzenesulfonate (PubChem CID 146272473) has the molecular formula C10H12BrNO4S and a molecular weight of 322.18 g/mol. Its IUPAC name is propylcarbamoyl 4-bromobenzenesulfonate.
| Compound Name | propylcarbamoyl 4-bromobenzenesulfonate |
|---|---|
| PubChem CID | 146272473 |
| Molecular Formula | C10H12BrNO4S |
| Molecular Weight | 322.18 g/mol |
| Exact Mass | 320.97 |
| IUPAC Name | propylcarbamoyl 4-bromobenzenesulfonate |
| SMILES | CCCNC(=O)OS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H12BrNO4S/c1-2-7-12-10(13)16-17(14,15)9-5-3-8(11)4-6-9/h3-6H,2,7H2,1H3,(H,12,13) |
| InChIKey | BMJJRUNPUQIIHV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.18 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|