About [(1R)-1-(4-bromophenyl)prop-2-enyl] N-propylcarbamate
[(1R)-1-(4-bromophenyl)prop-2-enyl] N-propylcarbamate (PubChem CID 141398943) has the molecular formula C13H16BrNO2
and a molecular weight of 298.18 g/mol. Its IUPAC name is [(1R)-1-(4-bromophenyl)prop-2-enyl] N-propylcarbamate.
Molecular Properties
| Compound Name | [(1R)-1-(4-bromophenyl)prop-2-enyl] N-propylcarbamate |
| PubChem CID | 141398943 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | [(1R)-1-(4-bromophenyl)prop-2-enyl] N-propylcarbamate |
| SMILES | C=C[C@@H](OC(=O)NCCC)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H16BrNO2/c1-3-9-15-13(16)17-12(4-2)10-5-7-11(14)8-6-10/h4-8,12H,2-3,9H2,1H3,(H,15,16)/t12-/m1/s1 |
| InChIKey | YNCGIFJLTVNSNL-GFCCVEGCSA-N |
| XLogP | 3.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-(4-bromophenyl)prop-2-enyl] N-propylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-(4-bromophenyl)prop-2-enyl] N-propylcarbamate?
The IUPAC name of [(1R)-1-(4-bromophenyl)prop-2-enyl] N-propylcarbamate (CID 141398943) is [(1R)-1-(4-bromophenyl)prop-2-enyl] N-propylcarbamate.
What is the SMILES notation for [(1R)-1-(4-bromophenyl)prop-2-enyl] N-propylcarbamate?
The canonical SMILES for [(1R)-1-(4-bromophenyl)prop-2-enyl] N-propylcarbamate is C=C[C@@H](OC(=O)NCCC)c1ccc(Br)cc1.
What is the InChIKey of [(1R)-1-(4-bromophenyl)prop-2-enyl] N-propylcarbamate?
The InChIKey is YNCGIFJLTVNSNL-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H16BrNO2/c1-3-9-15-13(16)17-12(4-2)10-5-7-11(14)8-6-10/h4-8,12H,2-3,9H2,1H3,(H,15,16)/t12-/m1/s1.
What are the key properties of [(1R)-1-(4-bromophenyl)prop-2-enyl] N-propylcarbamate?
[(1R)-1-(4-bromophenyl)prop-2-enyl] N-propylcarbamate has a molecular weight of 298.18 g/mol, XLogP of 3.81, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-(4-bromophenyl)prop-2-enyl] N-propylcarbamate is sourced from PubChem (CID 141398943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).