About dihydroxymethyl N-propylcarbamate
dihydroxymethyl N-propylcarbamate (PubChem CID 174469308) has the molecular formula C5H11NO4
and a molecular weight of 149.15 g/mol. Its IUPAC name is dihydroxymethyl N-propylcarbamate.
Molecular Properties
| Compound Name | dihydroxymethyl N-propylcarbamate |
| PubChem CID | 174469308 |
| Molecular Formula | C5H11NO4 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | dihydroxymethyl N-propylcarbamate |
| SMILES | CCCNC(=O)OC(O)O |
| InChI | InChI=1S/C5H11NO4/c1-2-3-6-4(7)10-5(8)9/h5,8-9H,2-3H2,1H3,(H,6,7) |
| InChIKey | BWHMDLWKGRRAFB-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze dihydroxymethyl N-propylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxymethyl N-propylcarbamate?
The IUPAC name of dihydroxymethyl N-propylcarbamate (CID 174469308) is dihydroxymethyl N-propylcarbamate.
What is the SMILES notation for dihydroxymethyl N-propylcarbamate?
The canonical SMILES for dihydroxymethyl N-propylcarbamate is CCCNC(=O)OC(O)O.
What is the InChIKey of dihydroxymethyl N-propylcarbamate?
The InChIKey is BWHMDLWKGRRAFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO4/c1-2-3-6-4(7)10-5(8)9/h5,8-9H,2-3H2,1H3,(H,6,7).
What are the key properties of dihydroxymethyl N-propylcarbamate?
dihydroxymethyl N-propylcarbamate has a molecular weight of 149.15 g/mol, XLogP of -0.61, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxymethyl N-propylcarbamate is sourced from PubChem (CID 174469308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).