C12H23NO4 — CID 173052886
[(1S)-2-methyl-1-(propylcarbamoyloxy)propyl] 2-methylpropanoate (PubChem CID 173052886) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is [(1S)-2-methyl-1-(propylcarbamoyloxy)propyl] 2-methylpropanoate.
| Compound Name | [(1S)-2-methyl-1-(propylcarbamoyloxy)propyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 173052886 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | [(1S)-2-methyl-1-(propylcarbamoyloxy)propyl] 2-methylpropanoate |
| SMILES | CCCNC(=O)O[C@H](OC(=O)C(C)C)C(C)C |
| InChI | InChI=1S/C12H23NO4/c1-6-7-13-12(15)17-11(9(4)5)16-10(14)8(2)3/h8-9,11H,6-7H2,1-5H3,(H,13,15)/t11-/m0/s1 |
| InChIKey | CBYWNJNCDQRYKO-NSHDSACASA-N |
| XLogP | 2.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|