About silyl N-propylcarbamate
silyl N-propylcarbamate (PubChem CID 174599243) has the molecular formula C4H11NO2Si
and a molecular weight of 133.22 g/mol. Its IUPAC name is silyl N-propylcarbamate.
Molecular Properties
| Compound Name | silyl N-propylcarbamate |
| PubChem CID | 174599243 |
| Molecular Formula | C4H11NO2Si |
| Molecular Weight | 133.22 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | silyl N-propylcarbamate |
| SMILES | CCCNC(=O)O[SiH3] |
| InChI | InChI=1S/C4H11NO2Si/c1-2-3-5-4(6)7-8/h2-3H2,1,8H3,(H,5,6) |
| InChIKey | CCDWSQKAGWHTKH-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.22 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze silyl N-propylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silyl N-propylcarbamate?
The IUPAC name of silyl N-propylcarbamate (CID 174599243) is silyl N-propylcarbamate.
What is the SMILES notation for silyl N-propylcarbamate?
The canonical SMILES for silyl N-propylcarbamate is CCCNC(=O)O[SiH3].
What is the InChIKey of silyl N-propylcarbamate?
The InChIKey is CCDWSQKAGWHTKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO2Si/c1-2-3-5-4(6)7-8/h2-3H2,1,8H3,(H,5,6).
What are the key properties of silyl N-propylcarbamate?
silyl N-propylcarbamate has a molecular weight of 133.22 g/mol, XLogP of -0.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for silyl N-propylcarbamate is sourced from PubChem (CID 174599243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).