C12H23NO4 — CID 86303559
methyl (2S)-2,3,3-trimethyl-2-(propylcarbamoyloxy)butanoate (PubChem CID 86303559) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is methyl (2S)-2,3,3-trimethyl-2-(propylcarbamoyloxy)butanoate.
| Compound Name | methyl (2S)-2,3,3-trimethyl-2-(propylcarbamoyloxy)butanoate |
|---|---|
| PubChem CID | 86303559 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | methyl (2S)-2,3,3-trimethyl-2-(propylcarbamoyloxy)butanoate |
| SMILES | CCCNC(=O)O[C@](C)(C(=O)OC)C(C)(C)C |
| InChI | InChI=1S/C12H23NO4/c1-7-8-13-10(15)17-12(5,9(14)16-6)11(2,3)4/h7-8H2,1-6H3,(H,13,15)/t12-/m1/s1 |
| InChIKey | FWOSMGOMTBREPV-GFCCVEGCSA-N |
| XLogP | 2.10 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |