C8H14Cl3NO2 — CID 159172104
(1,1,1-trichloro-2-methylpropan-2-yl) N-propylcarbamate (PubChem CID 159172104) has the molecular formula C8H14Cl3NO2 and a molecular weight of 262.56 g/mol. Its IUPAC name is (1,1,1-trichloro-2-methylpropan-2-yl) N-propylcarbamate.
| Compound Name | (1,1,1-trichloro-2-methylpropan-2-yl) N-propylcarbamate |
|---|---|
| PubChem CID | 159172104 |
| Molecular Formula | C8H14Cl3NO2 |
| Molecular Weight | 262.56 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | (1,1,1-trichloro-2-methylpropan-2-yl) N-propylcarbamate |
| SMILES | CCCNC(=O)OC(C)(C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H14Cl3NO2/c1-4-5-12-6(13)14-7(2,3)8(9,10)11/h4-5H2,1-3H3,(H,12,13) |
| InChIKey | ANUIFHGORDNHOA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|