C9H16Cl3NO2 — CID 58798525
(1,1,1-trichloro-2-methylpropan-2-yl) N-tert-butylcarbamate (PubChem CID 58798525) has the molecular formula C9H16Cl3NO2 and a molecular weight of 276.59 g/mol. Its IUPAC name is (1,1,1-trichloro-2-methylpropan-2-yl) N-tert-butylcarbamate.
| Compound Name | (1,1,1-trichloro-2-methylpropan-2-yl) N-tert-butylcarbamate |
|---|---|
| PubChem CID | 58798525 |
| Molecular Formula | C9H16Cl3NO2 |
| Molecular Weight | 276.59 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | (1,1,1-trichloro-2-methylpropan-2-yl) N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC(C)(C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H16Cl3NO2/c1-7(2,3)13-6(14)15-8(4,5)9(10,11)12/h1-5H3,(H,13,14) |
| InChIKey | FIOQZNKLKLZPRL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.59 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|