C6H11Cl3O5P+ — CID 157067106
dihydroxy(oxo)phosphanium;(1,1,1-trichloro-2-methylpropan-2-yl) acetate (PubChem CID 157067106) has the molecular formula C6H11Cl3O5P+ and a molecular weight of 300.48 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;(1,1,1-trichloro-2-methylpropan-2-yl) acetate.
| Compound Name | dihydroxy(oxo)phosphanium;(1,1,1-trichloro-2-methylpropan-2-yl) acetate |
|---|---|
| PubChem CID | 157067106 |
| Molecular Formula | C6H11Cl3O5P+ |
| Molecular Weight | 300.48 g/mol |
| Exact Mass | 298.94 |
| IUPAC Name | dihydroxy(oxo)phosphanium;(1,1,1-trichloro-2-methylpropan-2-yl) acetate |
| SMILES | CC(=O)OC(C)(C)C(Cl)(Cl)Cl.O=[P+](O)O |
| InChI | InChI=1S/C6H9Cl3O2.HO3P/c1-4(10)11-5(2,3)6(7,8)9;1-4(2)3/h1-3H3;(H-,1,2,3)/p+1 |
| InChIKey | IOEVYXXSHVIKHD-UHFFFAOYSA-O |
| XLogP | 2.33 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|