C6H11Cl3O5PS+ — CID 160836552
hydroxy-oxo-sulfanylphosphanium;methyl (1,1,1-trichloro-2-methylpropan-2-yl) carbonate (PubChem CID 160836552) has the molecular formula C6H11Cl3O5PS+ and a molecular weight of 332.55 g/mol. Its IUPAC name is hydroxy-oxo-sulfanylphosphanium;methyl (1,1,1-trichloro-2-methylpropan-2-yl) carbonate.
| Compound Name | hydroxy-oxo-sulfanylphosphanium;methyl (1,1,1-trichloro-2-methylpropan-2-yl) carbonate |
|---|---|
| PubChem CID | 160836552 |
| Molecular Formula | C6H11Cl3O5PS+ |
| Molecular Weight | 332.55 g/mol |
| Exact Mass | 330.91 |
| IUPAC Name | hydroxy-oxo-sulfanylphosphanium;methyl (1,1,1-trichloro-2-methylpropan-2-yl) carbonate |
| SMILES | COC(=O)OC(C)(C)C(Cl)(Cl)Cl.O=[P+](O)S |
| InChI | InChI=1S/C6H9Cl3O3.HO2PS/c1-5(2,6(7,8)9)12-4(10)11-3;1-3(2)4/h1-3H3;(H-,1,2,4)/p+1 |
| InChIKey | LVQGANLZOFZLSB-UHFFFAOYSA-O |
| XLogP | 3.48 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|