C4H9Cl3O3PS+ — CID 158091534
hydroxy-oxo-sulfanylphosphanium;1,1,1-trichloro-2-methylpropan-2-ol (PubChem CID 158091534) has the molecular formula C4H9Cl3O3PS+ and a molecular weight of 274.51 g/mol. Its IUPAC name is hydroxy-oxo-sulfanylphosphanium;1,1,1-trichloro-2-methylpropan-2-ol.
| Compound Name | hydroxy-oxo-sulfanylphosphanium;1,1,1-trichloro-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 158091534 |
| Molecular Formula | C4H9Cl3O3PS+ |
| Molecular Weight | 274.51 g/mol |
| Exact Mass | 272.91 |
| IUPAC Name | hydroxy-oxo-sulfanylphosphanium;1,1,1-trichloro-2-methylpropan-2-ol |
| SMILES | CC(C)(O)C(Cl)(Cl)Cl.O=[P+](O)S |
| InChI | InChI=1S/C4H7Cl3O.HO2PS/c1-3(2,8)4(5,6)7;1-3(2)4/h8H,1-2H3;(H-,1,2,4)/p+1 |
| InChIKey | JDXDRJBTOYATLA-UHFFFAOYSA-O |
| XLogP | 2.69 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|