C6H13Cl3O3P+ — CID 158600655
dihydroxy(oxo)phosphanium;1,3,5-trichloro-3-methylpentane (PubChem CID 158600655) has the molecular formula C6H13Cl3O3P+ and a molecular weight of 270.50 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;1,3,5-trichloro-3-methylpentane.
| Compound Name | dihydroxy(oxo)phosphanium;1,3,5-trichloro-3-methylpentane |
|---|---|
| PubChem CID | 158600655 |
| Molecular Formula | C6H13Cl3O3P+ |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 268.97 |
| IUPAC Name | dihydroxy(oxo)phosphanium;1,3,5-trichloro-3-methylpentane |
| SMILES | CC(Cl)(CCCl)CCCl.O=[P+](O)O |
| InChI | InChI=1S/C6H11Cl3.HO3P/c1-6(9,2-4-7)3-5-8;1-4(2)3/h2-5H2,1H3;(H-,1,2,3)/p+1 |
| InChIKey | RIXLDVQNCDYXKY-UHFFFAOYSA-O |
| XLogP | 2.87 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|