C12H20Cl6O3P+ — CID 57165059
bis[2,4-dichloro-2-(2-chloroethyl)butoxy]-oxophosphanium (PubChem CID 57165059) has the molecular formula C12H20Cl6O3P+ and a molecular weight of 455.98 g/mol. Its IUPAC name is bis[2,4-dichloro-2-(2-chloroethyl)butoxy]-oxophosphanium.
| Compound Name | bis[2,4-dichloro-2-(2-chloroethyl)butoxy]-oxophosphanium |
|---|---|
| PubChem CID | 57165059 |
| Molecular Formula | C12H20Cl6O3P+ |
| Molecular Weight | 455.98 g/mol |
| Exact Mass | 452.93 |
| IUPAC Name | bis[2,4-dichloro-2-(2-chloroethyl)butoxy]-oxophosphanium |
| SMILES | O=[P+](OCC(Cl)(CCCl)CCCl)OCC(Cl)(CCCl)CCCl |
| InChI | InChI=1S/C12H20Cl6O3P/c13-5-1-11(17,2-6-14)9-20-22(19)21-10-12(18,3-7-15)4-8-16/h1-10H2/q+1 |
| InChIKey | GFCUOVHECUPMDZ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.98 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|