About bis(2-chloroethoxy)-oxophosphanium;chloroethane
bis(2-chloroethoxy)-oxophosphanium;chloroethane (PubChem CID 88520254) has the molecular formula C6H13Cl3O3P+
and a molecular weight of 270.50 g/mol. Its IUPAC name is bis(2-chloroethoxy)-oxophosphanium;chloroethane.
Molecular Properties
| Compound Name | bis(2-chloroethoxy)-oxophosphanium;chloroethane |
| PubChem CID | 88520254 |
| Molecular Formula | C6H13Cl3O3P+ |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 268.97 |
| IUPAC Name | bis(2-chloroethoxy)-oxophosphanium;chloroethane |
| SMILES | CCCl.O=[P+](OCCCl)OCCCl |
| InChI | InChI=1S/C4H8Cl2O3P.C2H5Cl/c5-1-3-8-10(7)9-4-2-6;1-2-3/h1-4H2;2H2,1H3/q+1; |
| InChIKey | DFPADPWNXRTMJH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2-chloroethoxy)-oxophosphanium;chloroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-chloroethoxy)-oxophosphanium;chloroethane?
The IUPAC name of bis(2-chloroethoxy)-oxophosphanium;chloroethane (CID 88520254) is bis(2-chloroethoxy)-oxophosphanium;chloroethane.
What is the SMILES notation for bis(2-chloroethoxy)-oxophosphanium;chloroethane?
The canonical SMILES for bis(2-chloroethoxy)-oxophosphanium;chloroethane is CCCl.O=[P+](OCCCl)OCCCl.
What is the InChIKey of bis(2-chloroethoxy)-oxophosphanium;chloroethane?
The InChIKey is DFPADPWNXRTMJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8Cl2O3P.C2H5Cl/c5-1-3-8-10(7)9-4-2-6;1-2-3/h1-4H2;2H2,1H3/q+1;.
What are the key properties of bis(2-chloroethoxy)-oxophosphanium;chloroethane?
bis(2-chloroethoxy)-oxophosphanium;chloroethane has a molecular weight of 270.50 g/mol, XLogP of 3.40, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-chloroethoxy)-oxophosphanium;chloroethane is sourced from PubChem (CID 88520254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).