About chloroethane;2-chloroethoxy-(1-hydroxypropoxy)-oxophosphanium
chloroethane;2-chloroethoxy-(1-hydroxypropoxy)-oxophosphanium (PubChem CID 21493293) has the molecular formula C7H16Cl2O4P+
and a molecular weight of 266.08 g/mol. Its IUPAC name is chloroethane;2-chloroethoxy-(1-hydroxypropoxy)-oxophosphanium.
Molecular Properties
| Compound Name | chloroethane;2-chloroethoxy-(1-hydroxypropoxy)-oxophosphanium |
| PubChem CID | 21493293 |
| Molecular Formula | C7H16Cl2O4P+ |
| Molecular Weight | 266.08 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | chloroethane;2-chloroethoxy-(1-hydroxypropoxy)-oxophosphanium |
| SMILES | CCC(O)O[P+](=O)OCCCl.CCCl |
| InChI | InChI=1S/C5H11ClO4P.C2H5Cl/c1-2-5(7)10-11(8)9-4-3-6;1-2-3/h5,7H,2-4H2,1H3;2H2,1H3/q+1; |
| InChIKey | PPBMNJPYWVHUOD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.08 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloroethane;2-chloroethoxy-(1-hydroxypropoxy)-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroethane;2-chloroethoxy-(1-hydroxypropoxy)-oxophosphanium?
The IUPAC name of chloroethane;2-chloroethoxy-(1-hydroxypropoxy)-oxophosphanium (CID 21493293) is chloroethane;2-chloroethoxy-(1-hydroxypropoxy)-oxophosphanium.
What is the SMILES notation for chloroethane;2-chloroethoxy-(1-hydroxypropoxy)-oxophosphanium?
The canonical SMILES for chloroethane;2-chloroethoxy-(1-hydroxypropoxy)-oxophosphanium is CCC(O)O[P+](=O)OCCCl.CCCl.
What is the InChIKey of chloroethane;2-chloroethoxy-(1-hydroxypropoxy)-oxophosphanium?
The InChIKey is PPBMNJPYWVHUOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11ClO4P.C2H5Cl/c1-2-5(7)10-11(8)9-4-3-6;1-2-3/h5,7H,2-4H2,1H3;2H2,1H3/q+1;.
What are the key properties of chloroethane;2-chloroethoxy-(1-hydroxypropoxy)-oxophosphanium?
chloroethane;2-chloroethoxy-(1-hydroxypropoxy)-oxophosphanium has a molecular weight of 266.08 g/mol, XLogP of 2.89, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chloroethane;2-chloroethoxy-(1-hydroxypropoxy)-oxophosphanium is sourced from PubChem (CID 21493293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).